C16H24N2 — CID 79677091
7-(3-tert-butylazetidin-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 79677091) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 7-(3-tert-butylazetidin-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(3-tert-butylazetidin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 79677091 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 7-(3-tert-butylazetidin-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)(C)C1CN(c2ccc3c(c2)NCCC3)C1 |
| InChI | InChI=1S/C16H24N2/c1-16(2,3)13-10-18(11-13)14-7-6-12-5-4-8-17-15(12)9-14/h6-7,9,13,17H,4-5,8,10-11H2,1-3H3 |
| InChIKey | BICXFHMJCBCHFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |