C16H18N2O2 — CID 64835545
6,6-dimethyl-3-(1,2,3,4-tetrahydroquinolin-7-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 64835545) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 6,6-dimethyl-3-(1,2,3,4-tetrahydroquinolin-7-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 6,6-dimethyl-3-(1,2,3,4-tetrahydroquinolin-7-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 64835545 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 6,6-dimethyl-3-(1,2,3,4-tetrahydroquinolin-7-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(c3ccc4c(c3)NCCC4)C(=O)C21 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2)12-13(16)15(20)18(14(12)19)10-6-5-9-4-3-7-17-11(9)8-10/h5-6,8,12-13,17H,3-4,7H2,1-2H3 |
| InChIKey | KXIOZFYMDBXHLK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|