C23H30N4O3 — CID 139338480
2-[(4-methoxyphenyl)methoxy]-N,N,N'-trimethyl-6-(methylideneamino)-4-morpholin-4-ylbenzenecarboximidamide (PubChem CID 139338480) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]-N,N,N'-trimethyl-6-(methylideneamino)-4-morpholin-4-ylbenzenecarboximidamide.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]-N,N,N'-trimethyl-6-(methylideneamino)-4-morpholin-4-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 139338480 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]-N,N,N'-trimethyl-6-(methylideneamino)-4-morpholin-4-ylbenzenecarboximidamide |
| SMILES | C=Nc1cc(N2CCOCC2)cc(OCc2ccc(OC)cc2)c1/C(=N/C)N(C)C |
| InChI | InChI=1S/C23H30N4O3/c1-24-20-14-18(27-10-12-29-13-11-27)15-21(22(20)23(25-2)26(3)4)30-16-17-6-8-19(28-5)9-7-17/h6-9,14-15H,1,10-13,16H2,2-5H3/b25-23- |
| InChIKey | YKKSGBVEPLWRSJ-BZZOAKBMSA-N |
| XLogP | 3.38 |
| TPSA | 58.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|