C13H16IN3O3S — CID 163815671
iodo-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]methanol (PubChem CID 163815671) has the molecular formula C13H16IN3O3S and a molecular weight of 421.26 g/mol. Its IUPAC name is iodo-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]methanol.
| Compound Name | iodo-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]methanol |
|---|---|
| PubChem CID | 163815671 |
| Molecular Formula | C13H16IN3O3S |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | iodo-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]methanol |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(O)I)nc12 |
| InChI | InChI=1S/C13H16IN3O3S/c1-19-9-3-2-8(17-4-6-20-7-5-17)11-10(9)15-13(21-11)16-12(14)18/h2-3,12,18H,4-7H2,1H3,(H,15,16) |
| InChIKey | NRCOWBHUCCXNOS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|