C21H29N5O5S — CID 87471895
methyl N-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-piperidin-4-ylethyl]carbamate (PubChem CID 87471895) has the molecular formula C21H29N5O5S and a molecular weight of 463.56 g/mol. Its IUPAC name is methyl N-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-piperidin-4-ylethyl]carbamate.
| Compound Name | methyl N-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-piperidin-4-ylethyl]carbamate |
|---|---|
| PubChem CID | 87471895 |
| Molecular Formula | C21H29N5O5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | methyl N-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxo-1-piperidin-4-ylethyl]carbamate |
| SMILES | COC(=O)NC(C(=O)Nc1nc2c(OC)ccc(N3CCOCC3)c2s1)C1CCNCC1 |
| InChI | InChI=1S/C21H29N5O5S/c1-29-15-4-3-14(26-9-11-31-12-10-26)18-17(15)23-20(32-18)25-19(27)16(24-21(28)30-2)13-5-7-22-8-6-13/h3-4,13,16,22H,5-12H2,1-2H3,(H,24,28)(H,23,25,27) |
| InChIKey | HKOLGVFWKTVOML-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|