C21H27N3O5S — CID 11561101
[(1S,3R)-3-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]cyclopentyl] acetate (PubChem CID 11561101) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is [(1S,3R)-3-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]cyclopentyl] acetate.
| Compound Name | [(1S,3R)-3-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 11561101 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [(1S,3R)-3-[2-[(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]cyclopentyl] acetate |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)C[C@@H]3CC[C@H](OC(C)=O)C3)nc12 |
| InChI | InChI=1S/C21H27N3O5S/c1-13(25)29-15-4-3-14(11-15)12-18(26)22-21-23-19-17(27-2)6-5-16(20(19)30-21)24-7-9-28-10-8-24/h5-6,14-15H,3-4,7-12H2,1-2H3,(H,22,23,26)/t14-,15+/m1/s1 |
| InChIKey | YJKMWBUEUAAONG-CABCVRRESA-N |
| XLogP | 3.20 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|