C21H21FN6O2 — CID 86578852
4-amino-5-[[4-(4-fluorophenyl)phenyl]diazenyl]-1-methyl-6-morpholin-4-ylpyrimidin-2-one (PubChem CID 86578852) has the molecular formula C21H21FN6O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-amino-5-[[4-(4-fluorophenyl)phenyl]diazenyl]-1-methyl-6-morpholin-4-ylpyrimidin-2-one.
| Compound Name | 4-amino-5-[[4-(4-fluorophenyl)phenyl]diazenyl]-1-methyl-6-morpholin-4-ylpyrimidin-2-one |
|---|---|
| PubChem CID | 86578852 |
| Molecular Formula | C21H21FN6O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-amino-5-[[4-(4-fluorophenyl)phenyl]diazenyl]-1-methyl-6-morpholin-4-ylpyrimidin-2-one |
| SMILES | Cn1c(N2CCOCC2)c(/N=N/c2ccc(-c3ccc(F)cc3)cc2)c(N)nc1=O |
| InChI | InChI=1S/C21H21FN6O2/c1-27-20(28-10-12-30-13-11-28)18(19(23)24-21(27)29)26-25-17-8-4-15(5-9-17)14-2-6-16(22)7-3-14/h2-9H,10-13H2,1H3,(H2,23,24,29)/b26-25+ |
| InChIKey | KOBDQFCPVRYILE-OCEACIFDSA-N |
| XLogP | 3.42 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|