C23H26FN5O2 — CID 29109950
(5S)-4-amino-5-(4-fluorophenyl)-8,8-dimethyl-2-morpholin-4-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one (PubChem CID 29109950) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is (5S)-4-amino-5-(4-fluorophenyl)-8,8-dimethyl-2-morpholin-4-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one.
| Compound Name | (5S)-4-amino-5-(4-fluorophenyl)-8,8-dimethyl-2-morpholin-4-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 29109950 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (5S)-4-amino-5-(4-fluorophenyl)-8,8-dimethyl-2-morpholin-4-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(N3CCOCC3)nc(N)c1[C@@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN5O2/c1-23(2)11-15-18(16(30)12-23)17(13-3-5-14(24)6-4-13)19-20(25)27-22(28-21(19)26-15)29-7-9-31-10-8-29/h3-6,17H,7-12H2,1-2H3,(H3,25,26,27,28)/t17-/m1/s1 |
| InChIKey | ZLZFWBYPNXAUFQ-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |