C25H29ClN4O3S — CID 136727475
(5R)-5-(4-chlorophenyl)-8,8-dimethyl-2-(2-morpholin-4-ylethylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136727475) has the molecular formula C25H29ClN4O3S and a molecular weight of 501.05 g/mol. Its IUPAC name is (5R)-5-(4-chlorophenyl)-8,8-dimethyl-2-(2-morpholin-4-ylethylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-5-(4-chlorophenyl)-8,8-dimethyl-2-(2-morpholin-4-ylethylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136727475 |
| Molecular Formula | C25H29ClN4O3S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | (5R)-5-(4-chlorophenyl)-8,8-dimethyl-2-(2-morpholin-4-ylethylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(SCCN3CCOCC3)[nH]c(=O)c1[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN4O3S/c1-25(2)13-17-20(18(31)14-25)19(15-3-5-16(26)6-4-15)21-22(27-17)28-24(29-23(21)32)34-12-9-30-7-10-33-11-8-30/h3-6,19H,7-14H2,1-2H3,(H2,27,28,29,32)/t19-/m1/s1 |
| InChIKey | ILTATAJUTJYZHB-LJQANCHMSA-N |
| XLogP | 4.05 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |