C26H33N3O2S — CID 135712427
8,8-dimethyl-2-(2-methylpropylsulfanyl)-5-(4-propan-2-ylphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135712427) has the molecular formula C26H33N3O2S and a molecular weight of 451.64 g/mol. Its IUPAC name is 8,8-dimethyl-2-(2-methylpropylsulfanyl)-5-(4-propan-2-ylphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-2-(2-methylpropylsulfanyl)-5-(4-propan-2-ylphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135712427 |
| Molecular Formula | C26H33N3O2S |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 8,8-dimethyl-2-(2-methylpropylsulfanyl)-5-(4-propan-2-ylphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC(C)CSc1nc2c(c(=O)[nH]1)C(c1ccc(C(C)C)cc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C26H33N3O2S/c1-14(2)13-32-25-28-23-22(24(31)29-25)20(17-9-7-16(8-10-17)15(3)4)21-18(27-23)11-26(5,6)12-19(21)30/h7-10,14-15,20H,11-13H2,1-6H3,(H2,27,28,29,31) |
| InChIKey | PQFRYVSCMURBGC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |