C23H25Cl2N3O2S — CID 135712406
5-(2,3-dichlorophenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135712406) has the molecular formula C23H25Cl2N3O2S and a molecular weight of 478.45 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(2,3-dichlorophenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135712406 |
| Molecular Formula | C23H25Cl2N3O2S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC(C)CSc1nc2c(c(=O)[nH]1)C(c1cccc(Cl)c1Cl)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C23H25Cl2N3O2S/c1-11(2)10-31-22-27-20-18(21(30)28-22)16(12-6-5-7-13(24)19(12)25)17-14(26-20)8-23(3,4)9-15(17)29/h5-7,11,16H,8-10H2,1-4H3,(H2,26,27,28,30) |
| InChIKey | VMVAJPXJGMJGRW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |