C31H35N3O4S — CID 135712429
5-(3-methoxy-4-phenylmethoxyphenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135712429) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is 5-(3-methoxy-4-phenylmethoxyphenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(3-methoxy-4-phenylmethoxyphenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135712429 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 5-(3-methoxy-4-phenylmethoxyphenyl)-8,8-dimethyl-2-(2-methylpropylsulfanyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC(C)C)[nH]c(=O)c32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H35N3O4S/c1-18(2)17-39-30-33-28-27(29(36)34-30)25(26-21(32-28)14-31(3,4)15-22(26)35)20-11-12-23(24(13-20)37-5)38-16-19-9-7-6-8-10-19/h6-13,18,25H,14-17H2,1-5H3,(H2,32,33,34,36) |
| InChIKey | KHTBWEBZGGMRIV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |