C23H26ClN3O2S — CID 136878461
(5S)-2-[(4-chlorophenyl)methylsulfanyl]-8,8-dimethyl-5-propan-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136878461) has the molecular formula C23H26ClN3O2S and a molecular weight of 444.00 g/mol. Its IUPAC name is (5S)-2-[(4-chlorophenyl)methylsulfanyl]-8,8-dimethyl-5-propan-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5S)-2-[(4-chlorophenyl)methylsulfanyl]-8,8-dimethyl-5-propan-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136878461 |
| Molecular Formula | C23H26ClN3O2S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (5S)-2-[(4-chlorophenyl)methylsulfanyl]-8,8-dimethyl-5-propan-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC(C)[C@H]1C2=C(CC(C)(C)CC2=O)Nc2nc(SCc3ccc(Cl)cc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C23H26ClN3O2S/c1-12(2)17-18-15(9-23(3,4)10-16(18)28)25-20-19(17)21(29)27-22(26-20)30-11-13-5-7-14(24)8-6-13/h5-8,12,17H,9-11H2,1-4H3,(H2,25,26,27,29)/t17-/m0/s1 |
| InChIKey | CVHNDELSLUPQBT-KRWDZBQOSA-N |
| XLogP | 5.52 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |