C24H28ClN5O — CID 29102176
(5R)-4-amino-5-(3-chlorophenyl)-8,8-dimethyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one (PubChem CID 29102176) has the molecular formula C24H28ClN5O and a molecular weight of 437.98 g/mol. Its IUPAC name is (5R)-4-amino-5-(3-chlorophenyl)-8,8-dimethyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one.
| Compound Name | (5R)-4-amino-5-(3-chlorophenyl)-8,8-dimethyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 29102176 |
| Molecular Formula | C24H28ClN5O |
| Molecular Weight | 437.98 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (5R)-4-amino-5-(3-chlorophenyl)-8,8-dimethyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(N3CCCCC3)nc(N)c1[C@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H28ClN5O/c1-24(2)12-16-19(17(31)13-24)18(14-7-6-8-15(25)11-14)20-21(26)28-23(29-22(20)27-16)30-9-4-3-5-10-30/h6-8,11,18H,3-5,9-10,12-13H2,1-2H3,(H3,26,27,28,29)/t18-/m0/s1 |
| InChIKey | FUWAQMQOERQVGV-SFHVURJKSA-N |
| XLogP | 4.90 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |