C19H18Cl2N4O2 — CID 135930690
2-amino-5-(3,4-dichlorophenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135930690) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 2-amino-5-(3,4-dichlorophenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-amino-5-(3,4-dichlorophenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135930690 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-amino-5-(3,4-dichlorophenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(N)[nH]c(=O)c1C2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c1-19(2)6-11-14(12(26)7-19)13(8-3-4-9(20)10(21)5-8)15-16(23-11)24-18(22)25-17(15)27/h3-5,13H,6-7H2,1-2H3,(H4,22,23,24,25,27) |
| InChIKey | UGJFZHKNASLSRD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |