C24H29N5O — CID 29102128
(5R)-4-amino-8,8-dimethyl-5-phenyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one (PubChem CID 29102128) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is (5R)-4-amino-8,8-dimethyl-5-phenyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one.
| Compound Name | (5R)-4-amino-8,8-dimethyl-5-phenyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 29102128 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (5R)-4-amino-8,8-dimethyl-5-phenyl-2-piperidin-1-yl-5,7,9,10-tetrahydropyrimido[4,5-b]quinolin-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(N3CCCCC3)nc(N)c1[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H29N5O/c1-24(2)13-16-19(17(30)14-24)18(15-9-5-3-6-10-15)20-21(25)27-23(28-22(20)26-16)29-11-7-4-8-12-29/h3,5-6,9-10,18H,4,7-8,11-14H2,1-2H3,(H3,25,26,27,28)/t18-/m0/s1 |
| InChIKey | HJGOWNNCEOUBKF-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |