C12H16N8O — CID 135744084
4-[(6-morpholin-4-yl-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135744084) has the molecular formula C12H16N8O and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-[(6-morpholin-4-yl-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(6-morpholin-4-yl-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135744084 |
| Molecular Formula | C12H16N8O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-[(6-morpholin-4-yl-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C12H16N8O/c13-11-10(12(14)19-18-11)17-16-8-1-2-9(15-7-8)20-3-5-21-6-4-20/h1-2,7H,3-6H2,(H5,13,14,18,19)/b17-16+ |
| InChIKey | CCUGOPWHTIFIKP-WUKNDPDISA-N |
| XLogP | 1.22 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|