C14H19N7O — CID 136641461
4-[(2-methyl-4-morpholin-3-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 136641461) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-[(2-methyl-4-morpholin-3-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(2-methyl-4-morpholin-3-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 136641461 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 4-[(2-methyl-4-morpholin-3-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Cc1cc(C2COCCN2)ccc1/N=N/c1c(N)n[nH]c1N |
| InChI | InChI=1S/C14H19N7O/c1-8-6-9(11-7-22-5-4-17-11)2-3-10(8)18-19-12-13(15)20-21-14(12)16/h2-3,6,11,17H,4-5,7H2,1H3,(H5,15,16,20,21)/b19-18+ |
| InChIKey | RUMACKQLWWVDAM-VHEBQXMUSA-N |
| XLogP | 1.96 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|