C11H11N7OS — CID 135744066
4-[(5-methoxy-1,3-benzothiazol-2-yl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135744066) has the molecular formula C11H11N7OS and a molecular weight of 289.32 g/mol. Its IUPAC name is 4-[(5-methoxy-1,3-benzothiazol-2-yl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(5-methoxy-1,3-benzothiazol-2-yl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135744066 |
| Molecular Formula | C11H11N7OS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[(5-methoxy-1,3-benzothiazol-2-yl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | COc1ccc2sc(/N=N/c3c(N)n[nH]c3N)nc2c1 |
| InChI | InChI=1S/C11H11N7OS/c1-19-5-2-3-7-6(4-5)14-11(20-7)18-15-8-9(12)16-17-10(8)13/h2-4H,1H3,(H5,12,13,16,17)/b18-15+ |
| InChIKey | DWDUWFVCFKCTLD-OBGWFSINSA-N |
| XLogP | 2.61 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|