C25H19ClN2O2S — CID 71741177
1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-(4-methoxyphenyl)methyl]naphthalen-2-ol (PubChem CID 71741177) has the molecular formula C25H19ClN2O2S and a molecular weight of 446.96 g/mol. Its IUPAC name is 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-(4-methoxyphenyl)methyl]naphthalen-2-ol.
| Compound Name | 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-(4-methoxyphenyl)methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 71741177 |
| Molecular Formula | C25H19ClN2O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-(4-methoxyphenyl)methyl]naphthalen-2-ol |
| SMILES | COc1ccc(C(Nc2nc3ccc(Cl)cc3s2)c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H19ClN2O2S/c1-30-18-10-6-16(7-11-18)24(23-19-5-3-2-4-15(19)8-13-21(23)29)28-25-27-20-12-9-17(26)14-22(20)31-25/h2-14,24,29H,1H3,(H,27,28) |
| InChIKey | HMKRSMRNWBKFQM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|