C34H25N5O4S — CID 155535590
1-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol (PubChem CID 155535590) has the molecular formula C34H25N5O4S and a molecular weight of 599.67 g/mol. Its IUPAC name is 1-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol.
| Compound Name | 1-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 155535590 |
| Molecular Formula | C34H25N5O4S |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | 1-[[(6-methoxy-1,3-benzothiazol-2-yl)amino]-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol |
| SMILES | COc1ccc2nc(NC(c3cn(-c4ccccc4)nc3-c3ccc([N+](=O)[O-])cc3)c3c(O)ccc4ccccc34)sc2c1 |
| InChI | InChI=1S/C34H25N5O4S/c1-43-25-16-17-28-30(19-25)44-34(35-28)36-33(31-26-10-6-5-7-21(26)13-18-29(31)40)27-20-38(23-8-3-2-4-9-23)37-32(27)22-11-14-24(15-12-22)39(41)42/h2-20,33,40H,1H3,(H,35,36) |
| InChIKey | WMAOIPDQNRBBFX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|