C34H25FN4O2S — CID 155568200
1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methyl]naphthalen-2-ol (PubChem CID 155568200) has the molecular formula C34H25FN4O2S and a molecular weight of 572.67 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methyl]naphthalen-2-ol.
| Compound Name | 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 155568200 |
| Molecular Formula | C34H25FN4O2S |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methyl]naphthalen-2-ol |
| SMILES | COc1ccc2nc(NC(c3cn(-c4ccccc4)nc3-c3ccc(F)cc3)c3c(O)ccc4ccccc34)sc2c1 |
| InChI | InChI=1S/C34H25FN4O2S/c1-41-25-16-17-28-30(19-25)42-34(36-28)37-33(31-26-10-6-5-7-21(26)13-18-29(31)40)27-20-39(24-8-3-2-4-9-24)38-32(27)22-11-14-23(35)15-12-22/h2-20,33,40H,1H3,(H,36,37) |
| InChIKey | PXTHCDZYUWETPZ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|