C33H22ClFN4OS — CID 155562856
1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol (PubChem CID 155562856) has the molecular formula C33H22ClFN4OS and a molecular weight of 577.08 g/mol. Its IUPAC name is 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol.
| Compound Name | 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 155562856 |
| Molecular Formula | C33H22ClFN4OS |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 1-[[(6-chloro-1,3-benzothiazol-2-yl)amino]-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]naphthalen-2-ol |
| SMILES | Oc1ccc2ccccc2c1C(Nc1nc2ccc(Cl)cc2s1)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H22ClFN4OS/c34-22-13-16-27-29(18-22)41-33(36-27)37-32(30-25-9-5-4-6-20(25)12-17-28(30)40)26-19-39(24-7-2-1-3-8-24)38-31(26)21-10-14-23(35)15-11-21/h1-19,32,40H,(H,36,37) |
| InChIKey | CXSOWFPBAYDJHF-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|