C15H13FN2O4PS+ — CID 122513378
[(4-fluorophenyl)-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methoxy]-hydroxy-oxophosphanium (PubChem CID 122513378) has the molecular formula C15H13FN2O4PS+ and a molecular weight of 367.32 g/mol. Its IUPAC name is [(4-fluorophenyl)-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methoxy]-hydroxy-oxophosphanium.
| Compound Name | [(4-fluorophenyl)-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 122513378 |
| Molecular Formula | C15H13FN2O4PS+ |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | [(4-fluorophenyl)-[(6-methoxy-1,3-benzothiazol-2-yl)amino]methoxy]-hydroxy-oxophosphanium |
| SMILES | COc1ccc2nc(NC(O[P+](=O)O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C15H12FN2O4PS/c1-21-11-6-7-12-13(8-11)24-15(17-12)18-14(22-23(19)20)9-2-4-10(16)5-3-9/h2-8,14H,1H3,(H-,17,18,19,20)/p+1 |
| InChIKey | QYUWECXUAUGCHQ-UHFFFAOYSA-O |
| XLogP | 4.22 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|