C15H12ClN5S — CID 3912410
N-(1,3-benzothiazol-2-ylimino)-N'-(4-chloroanilino)ethanimidamide (PubChem CID 3912410) has the molecular formula C15H12ClN5S and a molecular weight of 329.82 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylimino)-N'-(4-chloroanilino)ethanimidamide.
| Compound Name | N-(1,3-benzothiazol-2-ylimino)-N'-(4-chloroanilino)ethanimidamide |
|---|---|
| PubChem CID | 3912410 |
| Molecular Formula | C15H12ClN5S |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylimino)-N'-(4-chloroanilino)ethanimidamide |
| SMILES | CC(=NNc1ccc(Cl)cc1)/N=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H12ClN5S/c1-10(18-20-12-8-6-11(16)7-9-12)19-21-15-17-13-4-2-3-5-14(13)22-15/h2-9,20H,1H3/b18-10?,21-19+ |
| InChIKey | MRBIOXCMRCXSCW-SKIJQUQGSA-N |
| XLogP | 5.48 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|