C30H24N6O — CID 3114987
N-(4,6-diphenylpyrimidin-2-yl)imino-N'-(2-methoxyanilino)benzenecarboximidamide (PubChem CID 3114987) has the molecular formula C30H24N6O and a molecular weight of 484.56 g/mol. Its IUPAC name is N-(4,6-diphenylpyrimidin-2-yl)imino-N'-(2-methoxyanilino)benzenecarboximidamide.
| Compound Name | N-(4,6-diphenylpyrimidin-2-yl)imino-N'-(2-methoxyanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 3114987 |
| Molecular Formula | C30H24N6O |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-(4,6-diphenylpyrimidin-2-yl)imino-N'-(2-methoxyanilino)benzenecarboximidamide |
| SMILES | COc1ccccc1NN=C(/N=N/c1nc(-c2ccccc2)cc(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C30H24N6O/c1-37-28-20-12-11-19-25(28)33-34-29(24-17-9-4-10-18-24)35-36-30-31-26(22-13-5-2-6-14-22)21-27(32-30)23-15-7-3-8-16-23/h2-21,33H,1H3/b34-29?,36-35+ |
| InChIKey | WQKJUHAWEIXHJH-RBLHRJQXSA-N |
| XLogP | 7.38 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|