C21H20N4O2 — CID 6520538
N'-anilino-3,4-dimethoxy-N-phenyliminobenzenecarboximidamide (PubChem CID 6520538) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N'-anilino-3,4-dimethoxy-N-phenyliminobenzenecarboximidamide.
| Compound Name | N'-anilino-3,4-dimethoxy-N-phenyliminobenzenecarboximidamide |
|---|---|
| PubChem CID | 6520538 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N'-anilino-3,4-dimethoxy-N-phenyliminobenzenecarboximidamide |
| SMILES | COc1ccc(C(/N=N/c2ccccc2)=N\Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H20N4O2/c1-26-19-14-13-16(15-20(19)27-2)21(24-22-17-9-5-3-6-10-17)25-23-18-11-7-4-8-12-18/h3-15,22H,1-2H3/b24-21+,25-23+ |
| InChIKey | KMCUNJFFGXRSMF-OJKLJAQXSA-N |
| XLogP | 5.26 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|