C26H22N4O5 — CID 135487999
N-[(Z)-[(3,4-dimethoxyphenyl)-[(3-methylphenyl)diazenyl]methylidene]amino]-2-oxochromene-3-carboxamide (PubChem CID 135487999) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is N-[(Z)-[(3,4-dimethoxyphenyl)-[(3-methylphenyl)diazenyl]methylidene]amino]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(Z)-[(3,4-dimethoxyphenyl)-[(3-methylphenyl)diazenyl]methylidene]amino]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 135487999 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[(Z)-[(3,4-dimethoxyphenyl)-[(3-methylphenyl)diazenyl]methylidene]amino]-2-oxochromene-3-carboxamide |
| SMILES | COc1ccc(C(=N/NC(=O)c2cc3ccccc3oc2=O)/N=N/c2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C26H22N4O5/c1-16-7-6-9-19(13-16)27-28-24(18-11-12-22(33-2)23(15-18)34-3)29-30-25(31)20-14-17-8-4-5-10-21(17)35-26(20)32/h4-15H,1-3H3,(H,30,31)/b28-27+,29-24- |
| InChIKey | PAOKCFWATNBWAJ-LTQYOYQDSA-N |
| XLogP | 4.99 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|