About [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate
[4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate (PubChem CID 3841289) has the molecular formula C21H18N4O2
and a molecular weight of 358.40 g/mol. Its IUPAC name is [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate.
Molecular Properties
| Compound Name | [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate |
| PubChem CID | 3841289 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=NNc2ccccc2)/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-16(26)27-20-14-12-17(13-15-20)21(24-22-18-8-4-2-5-9-18)25-23-19-10-6-3-7-11-19/h2-15,22H,1H3/b24-21?,25-23+ |
| InChIKey | PDDLRCIEFFKZHJ-FCTDIGPBSA-N |
| XLogP | 5.17 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate?
The IUPAC name of [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate (CID 3841289) is [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate.
What is the SMILES notation for [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate?
The canonical SMILES for [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate is CC(=O)Oc1ccc(C(=NNc2ccccc2)/N=N/c2ccccc2)cc1.
What is the InChIKey of [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate?
The InChIKey is PDDLRCIEFFKZHJ-FCTDIGPBSA-N. The full InChI is InChI=1S/C21H18N4O2/c1-16(26)27-20-14-12-17(13-15-20)21(24-22-18-8-4-2-5-9-18)25-23-19-10-6-3-7-11-19/h2-15,22H,1H3/b24-21?,25-23+.
What are the key properties of [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate?
[4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate has a molecular weight of 358.40 g/mol, XLogP of 5.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(N'-anilino-N-phenyliminocarbamimidoyl)phenyl] acetate is sourced from PubChem (CID 3841289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).