About bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+)
bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) (PubChem CID 5489934) has the molecular formula C26H22HgN8S2
and a molecular weight of 711.24 g/mol. Its IUPAC name is bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+).
Molecular Properties
| Compound Name | bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) |
| PubChem CID | 5489934 |
| Molecular Formula | C26H22HgN8S2 |
| Molecular Weight | 711.24 g/mol |
| Exact Mass | 712.11 |
| IUPAC Name | bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) |
| SMILES | [Hg+2].[S-]C(=N\Nc1ccccc1)/N=N/c1ccccc1.[S-]C(=N\Nc1ccccc1)/N=N/c1ccccc1 |
| InChI | InChI=1S/2C13H12N4S.Hg/c2*18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12;/h2*1-10,14H,(H,16,18);/q;;+2/p-2/b2*17-15+; |
| InChIKey | JNLPWEHDIDONKL-RVUOTHGYSA-L |
| XLogP | 7.40 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.24 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+)?
The IUPAC name of bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) (CID 5489934) is bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+).
What is the SMILES notation for bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+)?
The canonical SMILES for bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) is [Hg+2].[S-]C(=N\Nc1ccccc1)/N=N/c1ccccc1.[S-]C(=N\Nc1ccccc1)/N=N/c1ccccc1.
What is the InChIKey of bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+)?
The InChIKey is JNLPWEHDIDONKL-RVUOTHGYSA-L. The full InChI is InChI=1S/2C13H12N4S.Hg/c2*18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12;/h2*1-10,14H,(H,16,18);/q;;+2/p-2/b2*17-15+;.
What are the key properties of bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+)?
bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) has a molecular weight of 711.24 g/mol, XLogP of 7.40, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N'-anilino-N-phenyliminocarbamimidothioate);mercury(2+) is sourced from PubChem (CID 5489934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).