About N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide
N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide (PubChem CID 6373583) has the molecular formula C21H19N5O
and a molecular weight of 357.42 g/mol. Its IUPAC name is N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide |
| PubChem CID | 6373583 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=N/Nc2ccccc2)/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N5O/c1-16(27)22-18-14-12-17(13-15-18)21(25-23-19-8-4-2-5-9-19)26-24-20-10-6-3-7-11-20/h2-15,23H,1H3,(H,22,27)/b25-21-,26-24+ |
| InChIKey | CQWZKVXGGZVBCO-LXGJOWSGSA-N |
| XLogP | 5.20 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide?
The IUPAC name of N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide (CID 6373583) is N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide is CC(=O)Nc1ccc(C(=N/Nc2ccccc2)/N=N/c2ccccc2)cc1.
What is the InChIKey of N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide?
The InChIKey is CQWZKVXGGZVBCO-LXGJOWSGSA-N. The full InChI is InChI=1S/C21H19N5O/c1-16(27)22-18-14-12-17(13-15-18)21(25-23-19-8-4-2-5-9-19)26-24-20-10-6-3-7-11-20/h2-15,23H,1H3,(H,22,27)/b25-21-,26-24+.
What are the key properties of N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide?
N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide has a molecular weight of 357.42 g/mol, XLogP of 5.20, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(Z)-N'-anilino-N-phenyliminocarbamimidoyl]phenyl]acetamide is sourced from PubChem (CID 6373583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).