C22H18N6O2S — CID 135530116
4-hydroxy-3-methoxy-N-phenylimino-N'-[4-(pyridin-2-ylamino)-1,3-thiazol-2-yl]benzenecarboximidamide (PubChem CID 135530116) has the molecular formula C22H18N6O2S and a molecular weight of 430.49 g/mol. Its IUPAC name is 4-hydroxy-3-methoxy-N-phenylimino-N'-[4-(pyridin-2-ylamino)-1,3-thiazol-2-yl]benzenecarboximidamide.
| Compound Name | 4-hydroxy-3-methoxy-N-phenylimino-N'-[4-(pyridin-2-ylamino)-1,3-thiazol-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 135530116 |
| Molecular Formula | C22H18N6O2S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-hydroxy-3-methoxy-N-phenylimino-N'-[4-(pyridin-2-ylamino)-1,3-thiazol-2-yl]benzenecarboximidamide |
| SMILES | COc1cc(C(=N/c2nc(Nc3ccccn3)cs2)/N=N/c2ccccc2)ccc1O |
| InChI | InChI=1S/C22H18N6O2S/c1-30-18-13-15(10-11-17(18)29)21(28-27-16-7-3-2-4-8-16)26-22-25-20(14-31-22)24-19-9-5-6-12-23-19/h2-14,29H,1H3,(H,23,24)/b26-21-,28-27+ |
| InChIKey | ZKPMLPWOFYOSAF-DOQHNZKESA-N |
| XLogP | 5.86 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|