C14H9ClN2S2 — CID 886218
N-(2-chlorophenyl)-1,3-benzothiazole-2-carbothioamide (PubChem CID 886218) has the molecular formula C14H9ClN2S2 and a molecular weight of 304.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1,3-benzothiazole-2-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-1,3-benzothiazole-2-carbothioamide |
|---|---|
| PubChem CID | 886218 |
| Molecular Formula | C14H9ClN2S2 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-(2-chlorophenyl)-1,3-benzothiazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H9ClN2S2/c15-9-5-1-2-6-10(9)16-13(18)14-17-11-7-3-4-8-12(11)19-14/h1-8H,(H,16,18) |
| InChIKey | GKNCIURXRFMHSA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|