C16H14N2OS2 — CID 886259
N-(4-ethoxyphenyl)-1,3-benzothiazole-2-carbothioamide (PubChem CID 886259) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,3-benzothiazole-2-carbothioamide.
| Compound Name | N-(4-ethoxyphenyl)-1,3-benzothiazole-2-carbothioamide |
|---|---|
| PubChem CID | 886259 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,3-benzothiazole-2-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H14N2OS2/c1-2-19-12-9-7-11(8-10-12)17-15(20)16-18-13-5-3-4-6-14(13)21-16/h3-10H,2H2,1H3,(H,17,20) |
| InChIKey | MYXYJEPIAOIYDI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|