C24H19N5OS2 — CID 5229978
N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 5229978) has the molecular formula C24H19N5OS2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 5229978 |
| Molecular Formula | C24H19N5OS2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | CCOc1ccc(/N=C(\NN=Cc2nc3ccccc3s2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C24H19N5OS2/c1-2-30-17-13-11-16(12-14-17)26-23(24-28-19-8-4-6-10-21(19)32-24)29-25-15-22-27-18-7-3-5-9-20(18)31-22/h3-15H,2H2,1H3,(H,26,29) |
| InChIKey | IVMRFSGSLLANHL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|