C23H18N6S — CID 5230876
N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide (PubChem CID 5230876) has the molecular formula C23H18N6S and a molecular weight of 410.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 5230876 |
| Molecular Formula | C23H18N6S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethylideneamino)-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
| SMILES | Cc1ccc(/N=C(\NN=Cc2nc3ccccc3s2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H18N6S/c1-15-10-12-16(13-11-15)25-23(22-27-17-6-2-3-7-18(17)28-22)29-24-14-21-26-19-8-4-5-9-20(19)30-21/h2-14H,1H3,(H,25,29)(H,27,28) |
| InChIKey | BRYSQIJMSRUKCS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|