C21H16BrN5O — CID 5230324
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide (PubChem CID 5230324) has the molecular formula C21H16BrN5O and a molecular weight of 434.30 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 5230324 |
| Molecular Formula | C21H16BrN5O |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
| SMILES | Oc1ccc(Br)cc1C=NN/C(=N\c1ccccc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H16BrN5O/c22-15-10-11-19(28)14(12-15)13-23-27-21(24-16-6-2-1-3-7-16)20-25-17-8-4-5-9-18(17)26-20/h1-13,28H,(H,24,27)(H,25,26) |
| InChIKey | GAQCMIVWQXBHKL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|