C25H25N5O — CID 5230333
N-[(4-butoxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide (PubChem CID 5230333) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-[(4-butoxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 5230333 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[(4-butoxyphenyl)methylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
| SMILES | CCCCOc1ccc(C=NN/C(=N\c2ccccc2)c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H25N5O/c1-2-3-17-31-21-15-13-19(14-16-21)18-26-30-25(27-20-9-5-4-6-10-20)24-28-22-11-7-8-12-23(22)29-24/h4-16,18H,2-3,17H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | MTGVGQBXSJQNBU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|