C23H29N5 — CID 5231004
N'-(4-methylphenyl)-N-(octylideneamino)-1H-benzimidazole-2-carboximidamide (PubChem CID 5231004) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is N'-(4-methylphenyl)-N-(octylideneamino)-1H-benzimidazole-2-carboximidamide.
| Compound Name | N'-(4-methylphenyl)-N-(octylideneamino)-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 5231004 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | N'-(4-methylphenyl)-N-(octylideneamino)-1H-benzimidazole-2-carboximidamide |
| SMILES | CCCCCCCC=NN/C(=N\c1ccc(C)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H29N5/c1-3-4-5-6-7-10-17-24-28-23(25-19-15-13-18(2)14-16-19)22-26-20-11-8-9-12-21(20)27-22/h8-9,11-17H,3-7,10H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | AWQAOMQPFNXSKC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|