C22H16N6S — CID 135602566
N-[(E)-1,3-benzothiazol-2-ylmethylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide (PubChem CID 135602566) has the molecular formula C22H16N6S and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[(E)-1,3-benzothiazol-2-ylmethylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-[(E)-1,3-benzothiazol-2-ylmethylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 135602566 |
| Molecular Formula | C22H16N6S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[(E)-1,3-benzothiazol-2-ylmethylideneamino]-N'-phenyl-1H-benzimidazole-2-carboximidamide |
| SMILES | C(=N/N/C(=N\c1ccccc1)c1nc2ccccc2[nH]1)\c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H16N6S/c1-2-8-15(9-3-1)24-22(21-26-16-10-4-5-11-17(16)27-21)28-23-14-20-25-18-12-6-7-13-19(18)29-20/h1-14H,(H,24,28)(H,26,27)/b23-14+ |
| InChIKey | XVJYOVNXPWBPLA-OEAKJJBVSA-N |
| XLogP | 4.87 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|