C8H6N2OS — CID 135703658
(NZ)-N-(1,3-benzothiazol-2-ylmethylidene)hydroxylamine (PubChem CID 135703658) has the molecular formula C8H6N2OS and a molecular weight of 178.22 g/mol. Its IUPAC name is (NZ)-N-(1,3-benzothiazol-2-ylmethylidene)hydroxylamine.
| Compound Name | (NZ)-N-(1,3-benzothiazol-2-ylmethylidene)hydroxylamine |
|---|---|
| PubChem CID | 135703658 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | (NZ)-N-(1,3-benzothiazol-2-ylmethylidene)hydroxylamine |
| SMILES | O/N=C\c1nc2ccccc2s1 |
| InChI | InChI=1S/C8H6N2OS/c11-9-5-8-10-6-3-1-2-4-7(6)12-8/h1-5,11H/b9-5- |
| InChIKey | UXIOLCCKLQHTMD-UITAMQMPSA-N |
| XLogP | 2.10 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|