C28H31N5O2 — CID 5230861
N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide (PubChem CID 5230861) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 5230861 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
| SMILES | COc1cc(C=NN/C(=N\c2ccc(C)cc2)c2nc3ccccc3[nH]2)ccc1OCCC(C)C |
| InChI | InChI=1S/C28H31N5O2/c1-19(2)15-16-35-25-14-11-21(17-26(25)34-4)18-29-33-28(30-22-12-9-20(3)10-13-22)27-31-23-7-5-6-8-24(23)32-27/h5-14,17-19H,15-16H2,1-4H3,(H,30,33)(H,31,32) |
| InChIKey | LXVGQDUWWIPKCG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|