C23H21N5O — CID 135659542
N-[(Z)-(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide (PubChem CID 135659542) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is N-[(Z)-(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide.
| Compound Name | N-[(Z)-(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 135659542 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[(Z)-(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)-1H-benzimidazole-2-carboximidamide |
| SMILES | COc1ccccc1/C=N\N/C(=N\c1ccc(C)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H21N5O/c1-16-11-13-18(14-12-16)25-23(22-26-19-8-4-5-9-20(19)27-22)28-24-15-17-7-3-6-10-21(17)29-2/h3-15H,1-2H3,(H,25,28)(H,26,27)/b24-15- |
| InChIKey | ULOJPLJJFXUQDO-IWIPYMOSSA-N |
| XLogP | 4.58 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|