C25H22N4O — CID 4711094
N-[(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)quinoline-2-carboximidamide (PubChem CID 4711094) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)quinoline-2-carboximidamide.
| Compound Name | N-[(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 4711094 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(2-methoxyphenyl)methylideneamino]-N'-(4-methylphenyl)quinoline-2-carboximidamide |
| SMILES | COc1ccccc1C=NN/C(=N\c1ccc(C)cc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H22N4O/c1-18-11-14-21(15-12-18)27-25(23-16-13-19-7-3-5-9-22(19)28-23)29-26-17-20-8-4-6-10-24(20)30-2/h3-17H,1-2H3,(H,27,29) |
| InChIKey | HPQRMHAVRFYVLS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|