C26H21N5O — CID 135602484
N-[(E)-1H-indol-3-ylmethylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide (PubChem CID 135602484) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 135602484 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide |
| SMILES | COc1ccccc1/N=C(\N/N=C/c1c[nH]c2ccccc12)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H21N5O/c1-32-25-13-7-6-12-23(25)30-26(24-15-14-18-8-2-4-10-21(18)29-24)31-28-17-19-16-27-22-11-5-3-9-20(19)22/h2-17,27H,1H3,(H,30,31)/b28-17+ |
| InChIKey | QCKZIKPNJLCDEZ-OGLMXYFKSA-N |
| XLogP | 5.43 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|