C28H28N4O2 — CID 19260403
N-[(E)-(4-butoxyphenyl)methylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide (PubChem CID 19260403) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(E)-(4-butoxyphenyl)methylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide.
| Compound Name | N-[(E)-(4-butoxyphenyl)methylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 19260403 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[(E)-(4-butoxyphenyl)methylideneamino]-N'-(2-methoxyphenyl)quinoline-2-carboximidamide |
| SMILES | CCCCOc1ccc(/C=N/N/C(=N\c2ccccc2OC)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H28N4O2/c1-3-4-19-34-23-16-13-21(14-17-23)20-29-32-28(31-25-11-7-8-12-27(25)33-2)26-18-15-22-9-5-6-10-24(22)30-26/h5-18,20H,3-4,19H2,1-2H3,(H,31,32)/b29-20+ |
| InChIKey | GYVFRCLBSPPDJN-ZTKZIYFRSA-N |
| XLogP | 6.12 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|