C29H28Br2N4O — CID 5231016
N'-(2,6-dibromo-4-methylphenyl)-N-[[4-(3-methylbutoxy)phenyl]methylideneamino]quinoline-2-carboximidamide (PubChem CID 5231016) has the molecular formula C29H28Br2N4O and a molecular weight of 608.38 g/mol. Its IUPAC name is N'-(2,6-dibromo-4-methylphenyl)-N-[[4-(3-methylbutoxy)phenyl]methylideneamino]quinoline-2-carboximidamide.
| Compound Name | N'-(2,6-dibromo-4-methylphenyl)-N-[[4-(3-methylbutoxy)phenyl]methylideneamino]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 5231016 |
| Molecular Formula | C29H28Br2N4O |
| Molecular Weight | 608.38 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | N'-(2,6-dibromo-4-methylphenyl)-N-[[4-(3-methylbutoxy)phenyl]methylideneamino]quinoline-2-carboximidamide |
| SMILES | Cc1cc(Br)c(/N=C(\NN=Cc2ccc(OCCC(C)C)cc2)c2ccc3ccccc3n2)c(Br)c1 |
| InChI | InChI=1S/C29H28Br2N4O/c1-19(2)14-15-36-23-11-8-21(9-12-23)18-32-35-29(34-28-24(30)16-20(3)17-25(28)31)27-13-10-22-6-4-5-7-26(22)33-27/h4-13,16-19H,14-15H2,1-3H3,(H,34,35) |
| InChIKey | JFCRSWIICVSZFX-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.38 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|