C30H30Br2N4O2 — CID 4659163
N'-(2,6-dibromo-4-methylphenyl)-N-[(3-methoxy-4-pentoxyphenyl)methylideneamino]quinoline-2-carboximidamide (PubChem CID 4659163) has the molecular formula C30H30Br2N4O2 and a molecular weight of 638.40 g/mol. Its IUPAC name is N'-(2,6-dibromo-4-methylphenyl)-N-[(3-methoxy-4-pentoxyphenyl)methylideneamino]quinoline-2-carboximidamide.
| Compound Name | N'-(2,6-dibromo-4-methylphenyl)-N-[(3-methoxy-4-pentoxyphenyl)methylideneamino]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 4659163 |
| Molecular Formula | C30H30Br2N4O2 |
| Molecular Weight | 638.40 g/mol |
| Exact Mass | 636.07 |
| IUPAC Name | N'-(2,6-dibromo-4-methylphenyl)-N-[(3-methoxy-4-pentoxyphenyl)methylideneamino]quinoline-2-carboximidamide |
| SMILES | CCCCCOc1ccc(C=NN/C(=N\c2c(Br)cc(C)cc2Br)c2ccc3ccccc3n2)cc1OC |
| InChI | InChI=1S/C30H30Br2N4O2/c1-4-5-8-15-38-27-14-11-21(18-28(27)37-3)19-33-36-30(35-29-23(31)16-20(2)17-24(29)32)26-13-12-22-9-6-7-10-25(22)34-26/h6-7,9-14,16-19H,4-5,8,15H2,1-3H3,(H,35,36) |
| InChIKey | JOPAMFFXAMZKKQ-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.40 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|