C23H19ClN4OS — CID 5229787
N-[(2-chlorophenyl)methylideneamino]-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide (PubChem CID 5229787) has the molecular formula C23H19ClN4OS and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide |
|---|---|
| PubChem CID | 5229787 |
| Molecular Formula | C23H19ClN4OS |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-N'-(4-ethoxyphenyl)-1,3-benzothiazole-2-carboximidamide |
| SMILES | CCOc1ccc(/N=C(\NN=Cc2ccccc2Cl)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H19ClN4OS/c1-2-29-18-13-11-17(12-14-18)26-22(23-27-20-9-5-6-10-21(20)30-23)28-25-15-16-7-3-4-8-19(16)24/h3-15H,2H2,1H3,(H,26,28) |
| InChIKey | KQUIDHMUSKZAMG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|