C9H8N2S — CID 1083282
N-(1,3-benzothiazol-2-yl)ethanimine (PubChem CID 1083282) has the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)ethanimine.
| Compound Name | N-(1,3-benzothiazol-2-yl)ethanimine |
|---|---|
| PubChem CID | 1083282 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)ethanimine |
| SMILES | CC=Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8N2S/c1-2-10-9-11-7-5-3-4-6-8(7)12-9/h2-6H,1H3 |
| InChIKey | DLGSLGPTYFMNCI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|